About 2-tert-butylisoindole-1,3-dione;3-tert-butyl-3-methyloxetane
2-tert-butylisoindole-1,3-dione;3-tert-butyl-3-methyloxetane (PubChem CID 159277874) has the molecular formula C20H29NO3
and a molecular weight of 331.46 g/mol. Its IUPAC name is 2-tert-butylisoindole-1,3-dione;3-tert-butyl-3-methyloxetane.
Molecular Properties
| Compound Name | 2-tert-butylisoindole-1,3-dione;3-tert-butyl-3-methyloxetane |
| PubChem CID | 159277874 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 2-tert-butylisoindole-1,3-dione;3-tert-butyl-3-methyloxetane |
| SMILES | CC(C)(C)C1(C)COC1.CC(C)(C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C12H13NO2.C8H16O/c1-12(2,3)13-10(14)8-6-4-5-7-9(8)11(13)15;1-7(2,3)8(4)5-9-6-8/h4-7H,1-3H3;5-6H2,1-4H3 |
| InChIKey | KYNQWTKBWCPLMK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butylisoindole-1,3-dione;3-tert-butyl-3-methyloxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butylisoindole-1,3-dione;3-tert-butyl-3-methyloxetane?
The IUPAC name of 2-tert-butylisoindole-1,3-dione;3-tert-butyl-3-methyloxetane (CID 159277874) is 2-tert-butylisoindole-1,3-dione;3-tert-butyl-3-methyloxetane.
What is the SMILES notation for 2-tert-butylisoindole-1,3-dione;3-tert-butyl-3-methyloxetane?
The canonical SMILES for 2-tert-butylisoindole-1,3-dione;3-tert-butyl-3-methyloxetane is CC(C)(C)C1(C)COC1.CC(C)(C)N1C(=O)c2ccccc2C1=O.
What is the InChIKey of 2-tert-butylisoindole-1,3-dione;3-tert-butyl-3-methyloxetane?
The InChIKey is KYNQWTKBWCPLMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2.C8H16O/c1-12(2,3)13-10(14)8-6-4-5-7-9(8)11(13)15;1-7(2,3)8(4)5-9-6-8/h4-7H,1-3H3;5-6H2,1-4H3.
What are the key properties of 2-tert-butylisoindole-1,3-dione;3-tert-butyl-3-methyloxetane?
2-tert-butylisoindole-1,3-dione;3-tert-butyl-3-methyloxetane has a molecular weight of 331.46 g/mol, XLogP of 4.15, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butylisoindole-1,3-dione;3-tert-butyl-3-methyloxetane is sourced from PubChem (CID 159277874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).