C60H58F2N12O4 — CID 159278381
2-[2-(4-aminocyclohexyl)-4-(4-isocyano-1-methylpyrazol-5-yl)phenyl]-1-[2-(2-fluoro-6-methoxyphenyl)pyrimidin-4-yl]ethanone (PubChem CID 159278381) has the molecular formula C60H58F2N12O4 and a molecular weight of 1049.20 g/mol. Its IUPAC name is 2-[2-(4-aminocyclohexyl)-4-(4-isocyano-1-methylpyrazol-5-yl)phenyl]-1-[2-(2-fluoro-6-methoxyphenyl)pyrimidin-4-yl]ethanone.
| Compound Name | 2-[2-(4-aminocyclohexyl)-4-(4-isocyano-1-methylpyrazol-5-yl)phenyl]-1-[2-(2-fluoro-6-methoxyphenyl)pyrimidin-4-yl]ethanone |
|---|---|
| PubChem CID | 159278381 |
| Molecular Formula | C60H58F2N12O4 |
| Molecular Weight | 1049.20 g/mol |
| Exact Mass | 1048.47 |
| IUPAC Name | 2-[2-(4-aminocyclohexyl)-4-(4-isocyano-1-methylpyrazol-5-yl)phenyl]-1-[2-(2-fluoro-6-methoxyphenyl)pyrimidin-4-yl]ethanone |
| SMILES | [C-]#[N+]c1cnn(C)c1-c1ccc(CC(=O)c2ccnc(-c3c(F)cccc3OC)n2)c(C2CCC(N)CC2)c1.[C-]#[N+]c1cnn(C)c1-c1ccc(CC(=O)c2ccnc(-c3c(F)cccc3OC)n2)c(C2CCC(N)CC2)c1 |
| InChI | InChI=1S/2C30H29FN6O2/c2*1-33-25-17-35-37(2)29(25)20-8-7-19(22(15-20)18-9-11-21(32)12-10-18)16-26(38)24-13-14-34-30(36-24)28-23(31)5-4-6-27(28)39-3/h2*4-8,13-15,17-18,21H,9-12,16,32H2,2-3H3 |
| InChIKey | KYPHFVJXGARAEB-UHFFFAOYSA-N |
| XLogP | 11.31 |
| TPSA | 200.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1049.20 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|