C24H35FN4O3 — CID 159280218
tert-butyl (2S,5R)-4-[3-[[amino(cyclopropyl)methylidene]amino]-1-(4-fluorophenyl)-2-oxopropyl]-2,5-dimethylpiperazine-1-carboxylate (PubChem CID 159280218) has the molecular formula C24H35FN4O3 and a molecular weight of 446.57 g/mol. Its IUPAC name is tert-butyl (2S,5R)-4-[3-[[amino(cyclopropyl)methylidene]amino]-1-(4-fluorophenyl)-2-oxopropyl]-2,5-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S,5R)-4-[3-[[amino(cyclopropyl)methylidene]amino]-1-(4-fluorophenyl)-2-oxopropyl]-2,5-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 159280218 |
| Molecular Formula | C24H35FN4O3 |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | tert-butyl (2S,5R)-4-[3-[[amino(cyclopropyl)methylidene]amino]-1-(4-fluorophenyl)-2-oxopropyl]-2,5-dimethylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(C(=O)OC(C)(C)C)[C@@H](C)CN1C(C(=O)C/N=C(\N)C1CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H35FN4O3/c1-15-14-29(23(31)32-24(3,4)5)16(2)13-28(15)21(17-8-10-19(25)11-9-17)20(30)12-27-22(26)18-6-7-18/h8-11,15-16,18,21H,6-7,12-14H2,1-5H3,(H2,26,27)/t15-,16+,21?/m1/s1 |
| InChIKey | KYUXFXRWRYRMDO-ZQIYAJFXSA-N |
| XLogP | 3.53 |
| TPSA | 88.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|