C36H47NO11S2 — CID 159280560
methyl (2R,4R,5S)-5-acetamido-2-[3-(5-acetylsulfanyl-4-oxopentyl)sulfanylpropoxy]-6-[(1R,2R)-1,2-dihydroxy-5-oxo-5-(4-phenylphenyl)pentyl]-4-hydroxyoxane-2-carboxylate (PubChem CID 159280560) has the molecular formula C36H47NO11S2 and a molecular weight of 733.90 g/mol. Its IUPAC name is methyl (2R,4R,5S)-5-acetamido-2-[3-(5-acetylsulfanyl-4-oxopentyl)sulfanylpropoxy]-6-[(1R,2R)-1,2-dihydroxy-5-oxo-5-(4-phenylphenyl)pentyl]-4-hydroxyoxane-2-carboxylate.
| Compound Name | methyl (2R,4R,5S)-5-acetamido-2-[3-(5-acetylsulfanyl-4-oxopentyl)sulfanylpropoxy]-6-[(1R,2R)-1,2-dihydroxy-5-oxo-5-(4-phenylphenyl)pentyl]-4-hydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 159280560 |
| Molecular Formula | C36H47NO11S2 |
| Molecular Weight | 733.90 g/mol |
| Exact Mass | 733.26 |
| IUPAC Name | methyl (2R,4R,5S)-5-acetamido-2-[3-(5-acetylsulfanyl-4-oxopentyl)sulfanylpropoxy]-6-[(1R,2R)-1,2-dihydroxy-5-oxo-5-(4-phenylphenyl)pentyl]-4-hydroxyoxane-2-carboxylate |
| SMILES | COC(=O)[C@@]1(OCCCSCCCC(=O)CSC(C)=O)C[C@@H](O)[C@H](NC(C)=O)C([C@H](O)[C@H](O)CCC(=O)c2ccc(-c3ccccc3)cc2)O1 |
| InChI | InChI=1S/C36H47NO11S2/c1-23(38)37-32-31(43)21-36(35(45)46-3,47-18-8-20-49-19-7-11-28(40)22-50-24(2)39)48-34(32)33(44)30(42)17-16-29(41)27-14-12-26(13-15-27)25-9-5-4-6-10-25/h4-6,9-10,12-15,30-34,42-44H,7-8,11,16-22H2,1-3H3,(H,37,38)/t30-,31-,32+,33-,34?,36-/m1/s1 |
| InChIKey | MKVVKTHMBKCHMU-KNSAJXMQSA-N |
| XLogP | 3.33 |
| TPSA | 185.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.90 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|