About 1H-azepine;cyclohepta-1,4,6-triene-1-carboxylic acid
1H-azepine;cyclohepta-1,4,6-triene-1-carboxylic acid (PubChem CID 159281532) has the molecular formula C14H15NO2
and a molecular weight of 229.28 g/mol. Its IUPAC name is 1H-azepine;cyclohepta-1,4,6-triene-1-carboxylic acid.
Molecular Properties
| Compound Name | 1H-azepine;cyclohepta-1,4,6-triene-1-carboxylic acid |
| PubChem CID | 159281532 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 1H-azepine;cyclohepta-1,4,6-triene-1-carboxylic acid |
| SMILES | C1=CC=CNC=C1.O=C(O)C1=CCC=CC=C1 |
| InChI | InChI=1S/C8H8O2.C6H7N/c9-8(10)7-5-3-1-2-4-6-7;1-2-4-6-7-5-3-1/h1-3,5-6H,4H2,(H,9,10);1-7H |
| InChIKey | KYZBBTUFPVCRBN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-azepine;cyclohepta-1,4,6-triene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-azepine;cyclohepta-1,4,6-triene-1-carboxylic acid?
The IUPAC name of 1H-azepine;cyclohepta-1,4,6-triene-1-carboxylic acid (CID 159281532) is 1H-azepine;cyclohepta-1,4,6-triene-1-carboxylic acid.
What is the SMILES notation for 1H-azepine;cyclohepta-1,4,6-triene-1-carboxylic acid?
The canonical SMILES for 1H-azepine;cyclohepta-1,4,6-triene-1-carboxylic acid is C1=CC=CNC=C1.O=C(O)C1=CCC=CC=C1.
What is the InChIKey of 1H-azepine;cyclohepta-1,4,6-triene-1-carboxylic acid?
The InChIKey is KYZBBTUFPVCRBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.C6H7N/c9-8(10)7-5-3-1-2-4-6-7;1-2-4-6-7-5-3-1/h1-3,5-6H,4H2,(H,9,10);1-7H.
What are the key properties of 1H-azepine;cyclohepta-1,4,6-triene-1-carboxylic acid?
1H-azepine;cyclohepta-1,4,6-triene-1-carboxylic acid has a molecular weight of 229.28 g/mol, XLogP of 2.69, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-azepine;cyclohepta-1,4,6-triene-1-carboxylic acid is sourced from PubChem (CID 159281532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).