C24H24N2O3 — CID 159283055
(E)-4-[4-(4-imidazol-1-ylphenyl)phenyl]-1-(oxan-2-yloxy)but-3-en-2-one (PubChem CID 159283055) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is (E)-4-[4-(4-imidazol-1-ylphenyl)phenyl]-1-(oxan-2-yloxy)but-3-en-2-one.
| Compound Name | (E)-4-[4-(4-imidazol-1-ylphenyl)phenyl]-1-(oxan-2-yloxy)but-3-en-2-one |
|---|---|
| PubChem CID | 159283055 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | (E)-4-[4-(4-imidazol-1-ylphenyl)phenyl]-1-(oxan-2-yloxy)but-3-en-2-one |
| SMILES | O=C(/C=C/c1ccc(-c2ccc(-n3ccnc3)cc2)cc1)COC1CCCCO1 |
| InChI | InChI=1S/C24H24N2O3/c27-23(17-29-24-3-1-2-16-28-24)13-6-19-4-7-20(8-5-19)21-9-11-22(12-10-21)26-15-14-25-18-26/h4-15,18,24H,1-3,16-17H2/b13-6+ |
| InChIKey | KZDXMLASYDWNDA-AWNIVKPZSA-N |
| XLogP | 4.66 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|