About 1-bromo-3-methylbenzene;4-[4-(3-methylphenyl)phenyl]-4-oxobutanoic acid
1-bromo-3-methylbenzene;4-[4-(3-methylphenyl)phenyl]-4-oxobutanoic acid (PubChem CID 159283163) has the molecular formula C24H23BrO3
and a molecular weight of 439.35 g/mol. Its IUPAC name is 1-bromo-3-methylbenzene;4-[4-(3-methylphenyl)phenyl]-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 1-bromo-3-methylbenzene;4-[4-(3-methylphenyl)phenyl]-4-oxobutanoic acid |
| PubChem CID | 159283163 |
| Molecular Formula | C24H23BrO3 |
| Molecular Weight | 439.35 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 1-bromo-3-methylbenzene;4-[4-(3-methylphenyl)phenyl]-4-oxobutanoic acid |
| SMILES | Cc1cccc(-c2ccc(C(=O)CCC(=O)O)cc2)c1.Cc1cccc(Br)c1 |
| InChI | InChI=1S/C17H16O3.C7H7Br/c1-12-3-2-4-15(11-12)13-5-7-14(8-6-13)16(18)9-10-17(19)20;1-6-3-2-4-7(8)5-6/h2-8,11H,9-10H2,1H3,(H,19,20);2-5H,1H3 |
| InChIKey | KZEFTTKMEHKVIL-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.35 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-bromo-3-methylbenzene;4-[4-(3-methylphenyl)phenyl]-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-methylbenzene;4-[4-(3-methylphenyl)phenyl]-4-oxobutanoic acid?
The IUPAC name of 1-bromo-3-methylbenzene;4-[4-(3-methylphenyl)phenyl]-4-oxobutanoic acid (CID 159283163) is 1-bromo-3-methylbenzene;4-[4-(3-methylphenyl)phenyl]-4-oxobutanoic acid.
What is the SMILES notation for 1-bromo-3-methylbenzene;4-[4-(3-methylphenyl)phenyl]-4-oxobutanoic acid?
The canonical SMILES for 1-bromo-3-methylbenzene;4-[4-(3-methylphenyl)phenyl]-4-oxobutanoic acid is Cc1cccc(-c2ccc(C(=O)CCC(=O)O)cc2)c1.Cc1cccc(Br)c1.
What is the InChIKey of 1-bromo-3-methylbenzene;4-[4-(3-methylphenyl)phenyl]-4-oxobutanoic acid?
The InChIKey is KZEFTTKMEHKVIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O3.C7H7Br/c1-12-3-2-4-15(11-12)13-5-7-14(8-6-13)16(18)9-10-17(19)20;1-6-3-2-4-7(8)5-6/h2-8,11H,9-10H2,1H3,(H,19,20);2-5H,1H3.
What are the key properties of 1-bromo-3-methylbenzene;4-[4-(3-methylphenyl)phenyl]-4-oxobutanoic acid?
1-bromo-3-methylbenzene;4-[4-(3-methylphenyl)phenyl]-4-oxobutanoic acid has a molecular weight of 439.35 g/mol, XLogP of 6.47, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-methylbenzene;4-[4-(3-methylphenyl)phenyl]-4-oxobutanoic acid is sourced from PubChem (CID 159283163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).