C12H20N2O — CID 159283548
4-(piperidin-1-ylmethyl)-5-propan-2-yl-1,3-oxazole (PubChem CID 159283548) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is 4-(piperidin-1-ylmethyl)-5-propan-2-yl-1,3-oxazole.
| Compound Name | 4-(piperidin-1-ylmethyl)-5-propan-2-yl-1,3-oxazole |
|---|---|
| PubChem CID | 159283548 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 4-(piperidin-1-ylmethyl)-5-propan-2-yl-1,3-oxazole |
| SMILES | CC(C)c1ocnc1CN1CCCCC1 |
| InChI | InChI=1S/C12H20N2O/c1-10(2)12-11(13-9-15-12)8-14-6-4-3-5-7-14/h9-10H,3-8H2,1-2H3 |
| InChIKey | KZFKDGBACBRVCQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |