About 2,3-dihydro-1H-isoindol-2-ium;ethane;chloride
2,3-dihydro-1H-isoindol-2-ium;ethane;chloride (PubChem CID 159284201) has the molecular formula C12H22ClN
and a molecular weight of 215.77 g/mol. Its IUPAC name is 2,3-dihydro-1H-isoindol-2-ium;ethane;chloride.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-isoindol-2-ium;ethane;chloride |
| PubChem CID | 159284201 |
| Molecular Formula | C12H22ClN |
| Molecular Weight | 215.77 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 2,3-dihydro-1H-isoindol-2-ium;ethane;chloride |
| SMILES | CC.CC.[Cl-].c1ccc2c(c1)C[NH2+]C2 |
| InChI | InChI=1S/C8H9N.2C2H6.ClH/c1-2-4-8-6-9-5-7(8)3-1;2*1-2;/h1-4,9H,5-6H2;2*1-2H3;1H |
| InChIKey | CUZMUNUWUUYQFF-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.77 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,3-dihydro-1H-isoindol-2-ium;ethane;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-isoindol-2-ium;ethane;chloride?
The IUPAC name of 2,3-dihydro-1H-isoindol-2-ium;ethane;chloride (CID 159284201) is 2,3-dihydro-1H-isoindol-2-ium;ethane;chloride.
What is the SMILES notation for 2,3-dihydro-1H-isoindol-2-ium;ethane;chloride?
The canonical SMILES for 2,3-dihydro-1H-isoindol-2-ium;ethane;chloride is CC.CC.[Cl-].c1ccc2c(c1)C[NH2+]C2.
What is the InChIKey of 2,3-dihydro-1H-isoindol-2-ium;ethane;chloride?
The InChIKey is CUZMUNUWUUYQFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N.2C2H6.ClH/c1-2-4-8-6-9-5-7(8)3-1;2*1-2;/h1-4,9H,5-6H2;2*1-2H3;1H.
What are the key properties of 2,3-dihydro-1H-isoindol-2-ium;ethane;chloride?
2,3-dihydro-1H-isoindol-2-ium;ethane;chloride has a molecular weight of 215.77 g/mol, XLogP of -0.68, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-isoindol-2-ium;ethane;chloride is sourced from PubChem (CID 159284201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).