About 3,5-difluorophenol
3,5-difluorophenol (PubChem CID 159284632) has the molecular formula C12H8F4O2
and a molecular weight of 260.19 g/mol. Its IUPAC name is 3,5-difluorophenol.
Molecular Properties
| Compound Name | 3,5-difluorophenol |
| PubChem CID | 159284632 |
| Molecular Formula | C12H8F4O2 |
| Molecular Weight | 260.19 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 3,5-difluorophenol |
| SMILES | Oc1cc(F)cc(F)c1.Oc1cc(F)cc(F)c1 |
| InChI | InChI=1S/2C6H4F2O/c2*7-4-1-5(8)3-6(9)2-4/h2*1-3,9H |
| InChIKey | KZIWDBAZDNGCBS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.19 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-difluorophenol?
The IUPAC name of 3,5-difluorophenol (CID 159284632) is 3,5-difluorophenol.
What is the SMILES notation for 3,5-difluorophenol?
The canonical SMILES for 3,5-difluorophenol is Oc1cc(F)cc(F)c1.Oc1cc(F)cc(F)c1.
What is the InChIKey of 3,5-difluorophenol?
The InChIKey is KZIWDBAZDNGCBS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H4F2O/c2*7-4-1-5(8)3-6(9)2-4/h2*1-3,9H.
What are the key properties of 3,5-difluorophenol?
3,5-difluorophenol has a molecular weight of 260.19 g/mol, XLogP of 3.34, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-difluorophenol is sourced from PubChem (CID 159284632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).