C18H22O5 — CID 15928486
(3aR,5S,6S,6aR)-6-phenylmethoxyspiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-5-carbaldehyde (PubChem CID 15928486) has the molecular formula C18H22O5 and a molecular weight of 318.37 g/mol. Its IUPAC name is (3aR,5S,6S,6aR)-6-phenylmethoxyspiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-5-carbaldehyde.
| Compound Name | (3aR,5S,6S,6aR)-6-phenylmethoxyspiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-5-carbaldehyde |
|---|---|
| PubChem CID | 15928486 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | (3aR,5S,6S,6aR)-6-phenylmethoxyspiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-5-carbaldehyde |
| SMILES | O=C[C@H]1O[C@@H]2OC3(CCCCC3)O[C@@H]2[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C18H22O5/c19-11-14-15(20-12-13-7-3-1-4-8-13)16-17(21-14)23-18(22-16)9-5-2-6-10-18/h1,3-4,7-8,11,14-17H,2,5-6,9-10,12H2/t14-,15+,16-,17-/m1/s1 |
| InChIKey | FBCZEQIVPCIZMC-YYIAUSFCSA-N |
| XLogP | 2.57 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|