C33H43NO2Si — CID 15928550
(4R,5S)-5-[(1S)-1-(dibenzylamino)-3-methylbutyl]-4-[dimethyl(phenyl)silyl]-3,3-dimethyloxolan-2-one (PubChem CID 15928550) has the molecular formula C33H43NO2Si and a molecular weight of 513.80 g/mol. Its IUPAC name is (4R,5S)-5-[(1S)-1-(dibenzylamino)-3-methylbutyl]-4-[dimethyl(phenyl)silyl]-3,3-dimethyloxolan-2-one.
| Compound Name | (4R,5S)-5-[(1S)-1-(dibenzylamino)-3-methylbutyl]-4-[dimethyl(phenyl)silyl]-3,3-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 15928550 |
| Molecular Formula | C33H43NO2Si |
| Molecular Weight | 513.80 g/mol |
| Exact Mass | 513.31 |
| IUPAC Name | (4R,5S)-5-[(1S)-1-(dibenzylamino)-3-methylbutyl]-4-[dimethyl(phenyl)silyl]-3,3-dimethyloxolan-2-one |
| SMILES | CC(C)C[C@@H]([C@@H]1OC(=O)C(C)(C)[C@H]1[Si](C)(C)c1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C33H43NO2Si/c1-25(2)22-29(34(23-26-16-10-7-11-17-26)24-27-18-12-8-13-19-27)30-31(33(3,4)32(35)36-30)37(5,6)28-20-14-9-15-21-28/h7-21,25,29-31H,22-24H2,1-6H3/t29-,30-,31-/m0/s1 |
| InChIKey | QLRURKCRGSIWJV-CHQNGUEUSA-N |
| XLogP | 7.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.80 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|