C13H26O4Si — CID 159285766
(2S,4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxy-dideuteriomethyl]-2-methoxy-4-methyloxolan-3-one (PubChem CID 159285766) has the molecular formula C13H26O4Si and a molecular weight of 276.45 g/mol. Its IUPAC name is (2S,4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxy-dideuteriomethyl]-2-methoxy-4-methyloxolan-3-one.
| Compound Name | (2S,4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxy-dideuteriomethyl]-2-methoxy-4-methyloxolan-3-one |
|---|---|
| PubChem CID | 159285766 |
| Molecular Formula | C13H26O4Si |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (2S,4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxy-dideuteriomethyl]-2-methoxy-4-methyloxolan-3-one |
| SMILES | [2H]C([2H])(O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H](OC)C(=O)[C@@H]1C |
| InChI | InChI=1S/C13H26O4Si/c1-9-10(17-12(15-5)11(9)14)8-16-18(6,7)13(2,3)4/h9-10,12H,8H2,1-7H3/t9-,10-,12+/m1/s1/i8D2 |
| InChIKey | NHXRAFXQONNBFI-MFIAEUDMSA-N |
| XLogP | 2.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|