C24H27N3O3 — CID 159286158
4-acetylbenzonitrile;tert-butyl 2-[1-(4-cyanophenyl)ethylamino]acetate (PubChem CID 159286158) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is 4-acetylbenzonitrile;tert-butyl 2-[1-(4-cyanophenyl)ethylamino]acetate.
| Compound Name | 4-acetylbenzonitrile;tert-butyl 2-[1-(4-cyanophenyl)ethylamino]acetate |
|---|---|
| PubChem CID | 159286158 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 4-acetylbenzonitrile;tert-butyl 2-[1-(4-cyanophenyl)ethylamino]acetate |
| SMILES | CC(=O)c1ccc(C#N)cc1.CC(NCC(=O)OC(C)(C)C)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C15H20N2O2.C9H7NO/c1-11(13-7-5-12(9-16)6-8-13)17-10-14(18)19-15(2,3)4;1-7(11)9-4-2-8(6-10)3-5-9/h5-8,11,17H,10H2,1-4H3;2-5H,1H3 |
| InChIKey | KZNNBSPQWGOVMY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |