C29H45N3O2S — CID 159287952
(2S)-1-[(2S)-2-amino-2-cyclohexylacetyl]-N-[(2S,5R)-5,7-dimethyl-1-phenyl-3-sulfanylideneoctan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 159287952) has the molecular formula C29H45N3O2S and a molecular weight of 499.77 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-amino-2-cyclohexylacetyl]-N-[(2S,5R)-5,7-dimethyl-1-phenyl-3-sulfanylideneoctan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-amino-2-cyclohexylacetyl]-N-[(2S,5R)-5,7-dimethyl-1-phenyl-3-sulfanylideneoctan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 159287952 |
| Molecular Formula | C29H45N3O2S |
| Molecular Weight | 499.77 g/mol |
| Exact Mass | 499.32 |
| IUPAC Name | (2S)-1-[(2S)-2-amino-2-cyclohexylacetyl]-N-[(2S,5R)-5,7-dimethyl-1-phenyl-3-sulfanylideneoctan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)C[C@@H](C)CC(=S)[C@H](Cc1ccccc1)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)C1CCCCC1 |
| InChI | InChI=1S/C29H45N3O2S/c1-20(2)17-21(3)18-26(35)24(19-22-11-6-4-7-12-22)31-28(33)25-15-10-16-32(25)29(34)27(30)23-13-8-5-9-14-23/h4,6-7,11-12,20-21,23-25,27H,5,8-10,13-19,30H2,1-3H3,(H,31,33)/t21-,24+,25+,27+/m1/s1 |
| InChIKey | XLRBSBABJVOCAE-BQXMOOCUSA-N |
| XLogP | 5.05 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.77 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|