C44H34Cl2O3 — CID 159288888
5-chloro-2-(9,9-dimethylfluoren-1-yl)benzaldehyde;5-chloro-2-(9,9-dimethylfluoren-1-yl)benzoic acid (PubChem CID 159288888) has the molecular formula C44H34Cl2O3 and a molecular weight of 681.66 g/mol. Its IUPAC name is 5-chloro-2-(9,9-dimethylfluoren-1-yl)benzaldehyde;5-chloro-2-(9,9-dimethylfluoren-1-yl)benzoic acid.
| Compound Name | 5-chloro-2-(9,9-dimethylfluoren-1-yl)benzaldehyde;5-chloro-2-(9,9-dimethylfluoren-1-yl)benzoic acid |
|---|---|
| PubChem CID | 159288888 |
| Molecular Formula | C44H34Cl2O3 |
| Molecular Weight | 681.66 g/mol |
| Exact Mass | 680.19 |
| IUPAC Name | 5-chloro-2-(9,9-dimethylfluoren-1-yl)benzaldehyde;5-chloro-2-(9,9-dimethylfluoren-1-yl)benzoic acid |
| SMILES | CC1(C)c2ccccc2-c2cccc(-c3ccc(Cl)cc3C(=O)O)c21.CC1(C)c2ccccc2-c2cccc(-c3ccc(Cl)cc3C=O)c21 |
| InChI | InChI=1S/C22H17ClO2.C22H17ClO/c1-22(2)19-9-4-3-6-15(19)17-8-5-7-16(20(17)22)14-11-10-13(23)12-18(14)21(24)25;1-22(2)20-9-4-3-6-17(20)19-8-5-7-18(21(19)22)16-11-10-15(23)12-14(16)13-24/h3-12H,1-2H3,(H,24,25);3-13H,1-2H3 |
| InChIKey | KZVZPXZABAWTQP-UHFFFAOYSA-N |
| XLogP | 12.14 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.66 |
| LogP ≤ 5 | 12.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|