C11H18F3NO2 — CID 159289279
[(1R,2R)-2-piperidin-4-ylcyclopropyl]methanol;2,2,2-trifluoroacetaldehyde (PubChem CID 159289279) has the molecular formula C11H18F3NO2 and a molecular weight of 253.26 g/mol. Its IUPAC name is [(1R,2R)-2-piperidin-4-ylcyclopropyl]methanol;2,2,2-trifluoroacetaldehyde.
| Compound Name | [(1R,2R)-2-piperidin-4-ylcyclopropyl]methanol;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 159289279 |
| Molecular Formula | C11H18F3NO2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | [(1R,2R)-2-piperidin-4-ylcyclopropyl]methanol;2,2,2-trifluoroacetaldehyde |
| SMILES | O=CC(F)(F)F.OC[C@@H]1C[C@@H]1C1CCNCC1 |
| InChI | InChI=1S/C9H17NO.C2HF3O/c11-6-8-5-9(8)7-1-3-10-4-2-7;3-2(4,5)1-6/h7-11H,1-6H2;1H/t8-,9+;/m0./s1 |
| InChIKey | KZXDTRZVTKSPKM-OULXEKPRSA-N |
| XLogP | 1.36 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|