C21H39N3O3 — CID 159289992
(13S,17S)-17-[(1R,2S)-1,2-dihydroxyheptyl]-1,5,10-triazabicyclo[11.4.0]heptadec-15-en-11-one (PubChem CID 159289992) has the molecular formula C21H39N3O3 and a molecular weight of 381.56 g/mol. Its IUPAC name is (13S,17S)-17-[(1R,2S)-1,2-dihydroxyheptyl]-1,5,10-triazabicyclo[11.4.0]heptadec-15-en-11-one.
| Compound Name | (13S,17S)-17-[(1R,2S)-1,2-dihydroxyheptyl]-1,5,10-triazabicyclo[11.4.0]heptadec-15-en-11-one |
|---|---|
| PubChem CID | 159289992 |
| Molecular Formula | C21H39N3O3 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.30 |
| IUPAC Name | (13S,17S)-17-[(1R,2S)-1,2-dihydroxyheptyl]-1,5,10-triazabicyclo[11.4.0]heptadec-15-en-11-one |
| SMILES | CCCCC[C@H](O)[C@H](O)[C@@H]1C=CC[C@H]2CC(=O)NCCCCNCCCN21 |
| InChI | InChI=1S/C21H39N3O3/c1-2-3-4-11-19(25)21(27)18-10-7-9-17-16-20(26)23-14-6-5-12-22-13-8-15-24(17)18/h7,10,17-19,21-22,25,27H,2-6,8-9,11-16H2,1H3,(H,23,26)/t17-,18-,19-,21+/m0/s1 |
| InChIKey | KZZKPJBKEJKNAK-VNYTWHDVSA-N |
| XLogP | 1.57 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|