About decane;2-[3-methylbutyl(propan-2-yl)amino]ethanol
decane;2-[3-methylbutyl(propan-2-yl)amino]ethanol (PubChem CID 159290129) has the molecular formula C20H45NO
and a molecular weight of 315.59 g/mol. Its IUPAC name is decane;2-[3-methylbutyl(propan-2-yl)amino]ethanol.
Molecular Properties
| Compound Name | decane;2-[3-methylbutyl(propan-2-yl)amino]ethanol |
| PubChem CID | 159290129 |
| Molecular Formula | C20H45NO |
| Molecular Weight | 315.59 g/mol |
| Exact Mass | 315.35 |
| IUPAC Name | decane;2-[3-methylbutyl(propan-2-yl)amino]ethanol |
| SMILES | CC(C)CCN(CCO)C(C)C.CCCCCCCCCC |
| InChI | InChI=1S/C10H23NO.C10H22/c1-9(2)5-6-11(7-8-12)10(3)4;1-3-5-7-9-10-8-6-4-2/h9-10,12H,5-8H2,1-4H3;3-10H2,1-2H3 |
| InChIKey | KZZWOBOWTLVATG-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 315.59 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decane;2-[3-methylbutyl(propan-2-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decane;2-[3-methylbutyl(propan-2-yl)amino]ethanol?
The IUPAC name of decane;2-[3-methylbutyl(propan-2-yl)amino]ethanol (CID 159290129) is decane;2-[3-methylbutyl(propan-2-yl)amino]ethanol.
What is the SMILES notation for decane;2-[3-methylbutyl(propan-2-yl)amino]ethanol?
The canonical SMILES for decane;2-[3-methylbutyl(propan-2-yl)amino]ethanol is CC(C)CCN(CCO)C(C)C.CCCCCCCCCC.
What is the InChIKey of decane;2-[3-methylbutyl(propan-2-yl)amino]ethanol?
The InChIKey is KZZWOBOWTLVATG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23NO.C10H22/c1-9(2)5-6-11(7-8-12)10(3)4;1-3-5-7-9-10-8-6-4-2/h9-10,12H,5-8H2,1-4H3;3-10H2,1-2H3.
What are the key properties of decane;2-[3-methylbutyl(propan-2-yl)amino]ethanol?
decane;2-[3-methylbutyl(propan-2-yl)amino]ethanol has a molecular weight of 315.59 g/mol, XLogP of 5.88, 13 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decane;2-[3-methylbutyl(propan-2-yl)amino]ethanol is sourced from PubChem (CID 159290129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).