C30H26BO2S+ — CID 159290489
4,5,5-trimethyl-4-methyl-2-[6-(4-phenylphenyl)dibenzothiophen-4-yl]-1,3,2-dioxaborolane (PubChem CID 159290489) has the molecular formula C30H26BO2S+ and a molecular weight of 461.42 g/mol. Its IUPAC name is 4,5,5-trimethyl-4-methyl-2-[6-(4-phenylphenyl)dibenzothiophen-4-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,5,5-trimethyl-4-methyl-2-[6-(4-phenylphenyl)dibenzothiophen-4-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 159290489 |
| Molecular Formula | C30H26BO2S+ |
| Molecular Weight | 461.42 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 4,5,5-trimethyl-4-methyl-2-[6-(4-phenylphenyl)dibenzothiophen-4-yl]-1,3,2-dioxaborolane |
| SMILES | [CH2+]C1(C)OB(c2cccc3c2sc2c(-c4ccc(-c5ccccc5)cc4)cccc23)OC1(C)C |
| InChI | InChI=1S/C30H26BO2S/c1-29(2)30(3,4)33-31(32-29)26-15-9-14-25-24-13-8-12-23(27(24)34-28(25)26)22-18-16-21(17-19-22)20-10-6-5-7-11-20/h5-19H,1H2,2-4H3/q+1 |
| InChIKey | BSQDOMRPKYCEKX-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.42 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|