C30H42F2O7S2 — CID 159294201
2-(adamantane-1-carbonyloxy)-1,1-difluoroethanesulfonate;3,3-dimethyl-1-(4-methylphenyl)-2-(1,4-oxathian-4-ium-4-yl)butan-1-one (PubChem CID 159294201) has the molecular formula C30H42F2O7S2 and a molecular weight of 616.79 g/mol. Its IUPAC name is 2-(adamantane-1-carbonyloxy)-1,1-difluoroethanesulfonate;3,3-dimethyl-1-(4-methylphenyl)-2-(1,4-oxathian-4-ium-4-yl)butan-1-one.
| Compound Name | 2-(adamantane-1-carbonyloxy)-1,1-difluoroethanesulfonate;3,3-dimethyl-1-(4-methylphenyl)-2-(1,4-oxathian-4-ium-4-yl)butan-1-one |
|---|---|
| PubChem CID | 159294201 |
| Molecular Formula | C30H42F2O7S2 |
| Molecular Weight | 616.79 g/mol |
| Exact Mass | 616.23 |
| IUPAC Name | 2-(adamantane-1-carbonyloxy)-1,1-difluoroethanesulfonate;3,3-dimethyl-1-(4-methylphenyl)-2-(1,4-oxathian-4-ium-4-yl)butan-1-one |
| SMILES | Cc1ccc(C(=O)C([S+]2CCOCC2)C(C)(C)C)cc1.O=C(OCC(F)(F)S(=O)(=O)[O-])C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H25O2S.C13H18F2O5S/c1-13-5-7-14(8-6-13)15(18)16(17(2,3)4)20-11-9-19-10-12-20;14-13(15,21(17,18)19)7-20-11(16)12-4-8-1-9(5-12)3-10(2-8)6-12/h5-8,16H,9-12H2,1-4H3;8-10H,1-7H2,(H,17,18,19)/q+1;/p-1 |
| InChIKey | LAMWBOYJEDXMBA-UHFFFAOYSA-M |
| XLogP | 5.12 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.79 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|