About cyclohexanol;N,N-diethylethanamine;2-[2-hydroxyethyl(methyl)amino]ethanol
cyclohexanol;N,N-diethylethanamine;2-[2-hydroxyethyl(methyl)amino]ethanol (PubChem CID 159294837) has the molecular formula C17H40N2O3
and a molecular weight of 320.52 g/mol. Its IUPAC name is cyclohexanol;N,N-diethylethanamine;2-[2-hydroxyethyl(methyl)amino]ethanol.
Molecular Properties
| Compound Name | cyclohexanol;N,N-diethylethanamine;2-[2-hydroxyethyl(methyl)amino]ethanol |
| PubChem CID | 159294837 |
| Molecular Formula | C17H40N2O3 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.30 |
| IUPAC Name | cyclohexanol;N,N-diethylethanamine;2-[2-hydroxyethyl(methyl)amino]ethanol |
| SMILES | CCN(CC)CC.CN(CCO)CCO.OC1CCCCC1 |
| InChI | InChI=1S/C6H15N.C6H12O.C5H13NO2/c1-4-7(5-2)6-3;7-6-4-2-1-3-5-6;1-6(2-4-7)3-5-8/h4-6H2,1-3H3;6-7H,1-5H2;7-8H,2-5H2,1H3 |
| InChIKey | LAOSTKIQSXACGW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclohexanol;N,N-diethylethanamine;2-[2-hydroxyethyl(methyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanol;N,N-diethylethanamine;2-[2-hydroxyethyl(methyl)amino]ethanol?
The IUPAC name of cyclohexanol;N,N-diethylethanamine;2-[2-hydroxyethyl(methyl)amino]ethanol (CID 159294837) is cyclohexanol;N,N-diethylethanamine;2-[2-hydroxyethyl(methyl)amino]ethanol.
What is the SMILES notation for cyclohexanol;N,N-diethylethanamine;2-[2-hydroxyethyl(methyl)amino]ethanol?
The canonical SMILES for cyclohexanol;N,N-diethylethanamine;2-[2-hydroxyethyl(methyl)amino]ethanol is CCN(CC)CC.CN(CCO)CCO.OC1CCCCC1.
What is the InChIKey of cyclohexanol;N,N-diethylethanamine;2-[2-hydroxyethyl(methyl)amino]ethanol?
The InChIKey is LAOSTKIQSXACGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C6H12O.C5H13NO2/c1-4-7(5-2)6-3;7-6-4-2-1-3-5-6;1-6(2-4-7)3-5-8/h4-6H2,1-3H3;6-7H,1-5H2;7-8H,2-5H2,1H3.
What are the key properties of cyclohexanol;N,N-diethylethanamine;2-[2-hydroxyethyl(methyl)amino]ethanol?
cyclohexanol;N,N-diethylethanamine;2-[2-hydroxyethyl(methyl)amino]ethanol has a molecular weight of 320.52 g/mol, XLogP of 1.56, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanol;N,N-diethylethanamine;2-[2-hydroxyethyl(methyl)amino]ethanol is sourced from PubChem (CID 159294837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).