About 8-tert-butyl-1-(3,5-dimethylphenyl)-4-methylbenzo[h]isoquinoline
8-tert-butyl-1-(3,5-dimethylphenyl)-4-methylbenzo[h]isoquinoline (PubChem CID 159294940) has the molecular formula C26H27N
and a molecular weight of 353.51 g/mol. Its IUPAC name is 8-tert-butyl-1-(3,5-dimethylphenyl)-4-methylbenzo[h]isoquinoline.
Molecular Properties
| Compound Name | 8-tert-butyl-1-(3,5-dimethylphenyl)-4-methylbenzo[h]isoquinoline |
| PubChem CID | 159294940 |
| Molecular Formula | C26H27N |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 8-tert-butyl-1-(3,5-dimethylphenyl)-4-methylbenzo[h]isoquinoline |
| SMILES | Cc1cc(C)cc(-c2ncc(C)c3ccc4cc(C(C)(C)C)ccc4c23)c1 |
| InChI | InChI=1S/C26H27N/c1-16-11-17(2)13-20(12-16)25-24-22(18(3)15-27-25)9-7-19-14-21(26(4,5)6)8-10-23(19)24/h7-15H,1-6H3 |
| InChIKey | CYTNVZLCMAVMKD-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 8-tert-butyl-1-(3,5-dimethylphenyl)-4-methylbenzo[h]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-tert-butyl-1-(3,5-dimethylphenyl)-4-methylbenzo[h]isoquinoline?
The IUPAC name of 8-tert-butyl-1-(3,5-dimethylphenyl)-4-methylbenzo[h]isoquinoline (CID 159294940) is 8-tert-butyl-1-(3,5-dimethylphenyl)-4-methylbenzo[h]isoquinoline.
What is the SMILES notation for 8-tert-butyl-1-(3,5-dimethylphenyl)-4-methylbenzo[h]isoquinoline?
The canonical SMILES for 8-tert-butyl-1-(3,5-dimethylphenyl)-4-methylbenzo[h]isoquinoline is Cc1cc(C)cc(-c2ncc(C)c3ccc4cc(C(C)(C)C)ccc4c23)c1.
What is the InChIKey of 8-tert-butyl-1-(3,5-dimethylphenyl)-4-methylbenzo[h]isoquinoline?
The InChIKey is CYTNVZLCMAVMKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27N/c1-16-11-17(2)13-20(12-16)25-24-22(18(3)15-27-25)9-7-19-14-21(26(4,5)6)8-10-23(19)24/h7-15H,1-6H3.
What are the key properties of 8-tert-butyl-1-(3,5-dimethylphenyl)-4-methylbenzo[h]isoquinoline?
8-tert-butyl-1-(3,5-dimethylphenyl)-4-methylbenzo[h]isoquinoline has a molecular weight of 353.51 g/mol, XLogP of 7.28, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-tert-butyl-1-(3,5-dimethylphenyl)-4-methylbenzo[h]isoquinoline is sourced from PubChem (CID 159294940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).