C26H27N — CID 159294940
8-tert-butyl-1-(3,5-dimethylphenyl)-4-methylbenzo[h]isoquinoline (PubChem CID 159294940) has the molecular formula C26H27N and a molecular weight of 353.51 g/mol. Its IUPAC name is 8-tert-butyl-1-(3,5-dimethylphenyl)-4-methylbenzo[h]isoquinoline.
| Compound Name | 8-tert-butyl-1-(3,5-dimethylphenyl)-4-methylbenzo[h]isoquinoline |
|---|---|
| PubChem CID | 159294940 |
| Molecular Formula | C26H27N |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 8-tert-butyl-1-(3,5-dimethylphenyl)-4-methylbenzo[h]isoquinoline |
| SMILES | Cc1cc(C)cc(-c2ncc(C)c3ccc4cc(C(C)(C)C)ccc4c23)c1 |
| InChI | InChI=1S/C26H27N/c1-16-11-17(2)13-20(12-16)25-24-22(18(3)15-27-25)9-7-19-14-21(26(4,5)6)8-10-23(19)24/h7-15H,1-6H3 |
| InChIKey | CYTNVZLCMAVMKD-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|