C14H20ClNO3 — CID 159296460
(3S)-3-amino-4-[5-(3-chloropropyl)-2-methoxyphenyl]butanoic acid (PubChem CID 159296460) has the molecular formula C14H20ClNO3 and a molecular weight of 285.77 g/mol. Its IUPAC name is (3S)-3-amino-4-[5-(3-chloropropyl)-2-methoxyphenyl]butanoic acid.
| Compound Name | (3S)-3-amino-4-[5-(3-chloropropyl)-2-methoxyphenyl]butanoic acid |
|---|---|
| PubChem CID | 159296460 |
| Molecular Formula | C14H20ClNO3 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | (3S)-3-amino-4-[5-(3-chloropropyl)-2-methoxyphenyl]butanoic acid |
| SMILES | COc1ccc(CCCCl)cc1C[C@H](N)CC(=O)O |
| InChI | InChI=1S/C14H20ClNO3/c1-19-13-5-4-10(3-2-6-15)7-11(13)8-12(16)9-14(17)18/h4-5,7,12H,2-3,6,8-9,16H2,1H3,(H,17,18)/t12-/m0/s1 |
| InChIKey | VBIOQOVAJZGNDL-LBPRGKRZSA-N |
| XLogP | 2.21 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|