C46H46Cl2F6N6 — CID 159296869
6-chloro-2-[[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]methyl]-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene (PubChem CID 159296869) has the molecular formula C46H46Cl2F6N6 and a molecular weight of 867.81 g/mol. Its IUPAC name is 6-chloro-2-[[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]methyl]-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene.
| Compound Name | 6-chloro-2-[[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]methyl]-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene |
|---|---|
| PubChem CID | 159296869 |
| Molecular Formula | C46H46Cl2F6N6 |
| Molecular Weight | 867.81 g/mol |
| Exact Mass | 866.31 |
| IUPAC Name | 6-chloro-2-[[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]methyl]-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene |
| SMILES | FC(F)(F)c1ccccc1C1CCN(Cc2nc3cc(Cl)cc4c3n2CCC4)CC1.FC(F)(F)c1ccccc1C1CCN(Cc2nc3cc(Cl)cc4c3n2CCC4)CC1 |
| InChI | InChI=1S/2C23H23ClF3N3/c2*24-17-12-16-4-3-9-30-21(28-20(13-17)22(16)30)14-29-10-7-15(8-11-29)18-5-1-2-6-19(18)23(25,26)27/h2*1-2,5-6,12-13,15H,3-4,7-11,14H2 |
| InChIKey | LAVHWOOYHNRPTG-UHFFFAOYSA-N |
| XLogP | 12.07 |
| TPSA | 42.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.81 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |