C9H19NO6 — CID 15929700
N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]propanamide (PubChem CID 15929700) has the molecular formula C9H19NO6 and a molecular weight of 237.25 g/mol. Its IUPAC name is N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]propanamide.
| Compound Name | N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]propanamide |
|---|---|
| PubChem CID | 15929700 |
| Molecular Formula | C9H19NO6 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]propanamide |
| SMILES | CCC(=O)NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H19NO6/c1-2-7(14)10-3-5(12)8(15)9(16)6(13)4-11/h5-6,8-9,11-13,15-16H,2-4H2,1H3,(H,10,14)/t5-,6+,8+,9+/m0/s1 |
| InChIKey | MFYNLBVJDOLIMH-HIORRCEOSA-N |
| XLogP | -3.05 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |