C10H21NO6 — CID 15929701
N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]butanamide (PubChem CID 15929701) has the molecular formula C10H21NO6 and a molecular weight of 251.28 g/mol. Its IUPAC name is N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]butanamide.
| Compound Name | N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]butanamide |
|---|---|
| PubChem CID | 15929701 |
| Molecular Formula | C10H21NO6 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]butanamide |
| SMILES | CCCC(=O)NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H21NO6/c1-2-3-8(15)11-4-6(13)9(16)10(17)7(14)5-12/h6-7,9-10,12-14,16-17H,2-5H2,1H3,(H,11,15)/t6-,7+,9+,10+/m0/s1 |
| InChIKey | GVKHAMKBQJSGQI-MVHNUAHISA-N |
| XLogP | -2.66 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |