C30H28O6 — CID 159297209
1,3-bis(4-hydroxyphenyl)propan-2-one (PubChem CID 159297209) has the molecular formula C30H28O6 and a molecular weight of 484.55 g/mol. Its IUPAC name is 1,3-bis(4-hydroxyphenyl)propan-2-one.
| Compound Name | 1,3-bis(4-hydroxyphenyl)propan-2-one |
|---|---|
| PubChem CID | 159297209 |
| Molecular Formula | C30H28O6 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 1,3-bis(4-hydroxyphenyl)propan-2-one |
| SMILES | O=C(Cc1ccc(O)cc1)Cc1ccc(O)cc1.O=C(Cc1ccc(O)cc1)Cc1ccc(O)cc1 |
| InChI | InChI=1S/2C15H14O3/c2*16-13-5-1-11(2-6-13)9-15(18)10-12-3-7-14(17)8-4-12/h2*1-8,16-17H,9-10H2 |
| InChIKey | LAWKYWBXPHTHIG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |