C23H27NO11 — CID 15929736
[(2R,3S,4R,5R,6S)-5-[acetyl(benzoyl)amino]-3,4,6-triacetyloxyoxan-2-yl]methyl acetate (PubChem CID 15929736) has the molecular formula C23H27NO11 and a molecular weight of 493.47 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-[acetyl(benzoyl)amino]-3,4,6-triacetyloxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-[acetyl(benzoyl)amino]-3,4,6-triacetyloxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 15929736 |
| Molecular Formula | C23H27NO11 |
| Molecular Weight | 493.47 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-[acetyl(benzoyl)amino]-3,4,6-triacetyloxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC(C)=O)[C@H](N(C(C)=O)C(=O)c2ccccc2)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H27NO11/c1-12(25)24(22(30)17-9-7-6-8-10-17)19-21(33-15(4)28)20(32-14(3)27)18(11-31-13(2)26)35-23(19)34-16(5)29/h6-10,18-21,23H,11H2,1-5H3/t18-,19-,20-,21-,23-/m1/s1 |
| InChIKey | AOEHZDPAUNJLAA-XARADAHVSA-N |
| XLogP | 0.76 |
| TPSA | 151.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.47 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|