C36H36Cl2N2O8S2 — CID 159297368
4-phenoxazin-10-yl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole 2-oxide;3-phenoxazin-10-ylcyclohexane-1,2-diol;thionyl dichloride (PubChem CID 159297368) has the molecular formula C36H36Cl2N2O8S2 and a molecular weight of 759.73 g/mol. Its IUPAC name is 4-phenoxazin-10-yl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole 2-oxide;3-phenoxazin-10-ylcyclohexane-1,2-diol;thionyl dichloride.
| Compound Name | 4-phenoxazin-10-yl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole 2-oxide;3-phenoxazin-10-ylcyclohexane-1,2-diol;thionyl dichloride |
|---|---|
| PubChem CID | 159297368 |
| Molecular Formula | C36H36Cl2N2O8S2 |
| Molecular Weight | 759.73 g/mol |
| Exact Mass | 758.13 |
| IUPAC Name | 4-phenoxazin-10-yl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole 2-oxide;3-phenoxazin-10-ylcyclohexane-1,2-diol;thionyl dichloride |
| SMILES | O=S(Cl)Cl.O=S1OC2CCCC(N3c4ccccc4Oc4ccccc43)C2O1.OC1CCCC(N2c3ccccc3Oc3ccccc32)C1O |
| InChI | InChI=1S/C18H17NO4S.C18H19NO3.Cl2OS/c20-24-22-17-11-5-8-14(18(17)23-24)19-12-6-1-3-9-15(12)21-16-10-4-2-7-13(16)19;20-15-9-5-8-14(18(15)21)19-12-6-1-3-10-16(12)22-17-11-4-2-7-13(17)19;1-4(2)3/h1-4,6-7,9-10,14,17-18H,5,8,11H2;1-4,6-7,10-11,14-15,18,20-21H,5,8-9H2; |
| InChIKey | LAWYXPTVQCRAMF-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 118.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.73 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |