C30H30BBrN4O3 — CID 159298300
1-benzyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one;6-bromo-3-pyridin-4-yl-1H-indazole (PubChem CID 159298300) has the molecular formula C30H30BBrN4O3 and a molecular weight of 585.31 g/mol. Its IUPAC name is 1-benzyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one;6-bromo-3-pyridin-4-yl-1H-indazole.
| Compound Name | 1-benzyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one;6-bromo-3-pyridin-4-yl-1H-indazole |
|---|---|
| PubChem CID | 159298300 |
| Molecular Formula | C30H30BBrN4O3 |
| Molecular Weight | 585.31 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | 1-benzyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one;6-bromo-3-pyridin-4-yl-1H-indazole |
| SMILES | Brc1ccc2c(-c3ccncc3)n[nH]c2c1.CC1(C)OB(c2ccc(=O)n(Cc3ccccc3)c2)OC1(C)C |
| InChI | InChI=1S/C18H22BNO3.C12H8BrN3/c1-17(2)18(3,4)23-19(22-17)15-10-11-16(21)20(13-15)12-14-8-6-5-7-9-14;13-9-1-2-10-11(7-9)15-16-12(10)8-3-5-14-6-4-8/h5-11,13H,12H2,1-4H3;1-7H,(H,15,16) |
| InChIKey | LAZUOXXWBBQDSM-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.31 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|