C99H105N3O15 — CID 159298762
3-[3-[4-methoxy-3-(3-methylphenyl)phenyl]-2-oxopropyl]-8-methyl-7-(1-methylpiperidin-4-yl)oxychromen-2-one (PubChem CID 159298762) has the molecular formula C99H105N3O15 and a molecular weight of 1576.93 g/mol. Its IUPAC name is 3-[3-[4-methoxy-3-(3-methylphenyl)phenyl]-2-oxopropyl]-8-methyl-7-(1-methylpiperidin-4-yl)oxychromen-2-one.
| Compound Name | 3-[3-[4-methoxy-3-(3-methylphenyl)phenyl]-2-oxopropyl]-8-methyl-7-(1-methylpiperidin-4-yl)oxychromen-2-one |
|---|---|
| PubChem CID | 159298762 |
| Molecular Formula | C99H105N3O15 |
| Molecular Weight | 1576.93 g/mol |
| Exact Mass | 1575.75 |
| IUPAC Name | 3-[3-[4-methoxy-3-(3-methylphenyl)phenyl]-2-oxopropyl]-8-methyl-7-(1-methylpiperidin-4-yl)oxychromen-2-one |
| SMILES | COc1ccc(CC(=O)Cc2cc3ccc(OC4CCN(C)CC4)c(C)c3oc2=O)cc1-c1cccc(C)c1.COc1ccc(CC(=O)Cc2cc3ccc(OC4CCN(C)CC4)c(C)c3oc2=O)cc1-c1cccc(C)c1.COc1ccc(CC(=O)Cc2cc3ccc(OC4CCN(C)CC4)c(C)c3oc2=O)cc1-c1cccc(C)c1 |
| InChI | InChI=1S/3C33H35NO5/c3*1-21-6-5-7-24(16-21)29-18-23(8-10-31(29)37-4)17-27(35)20-26-19-25-9-11-30(22(2)32(25)39-33(26)36)38-28-12-14-34(3)15-13-28/h3*5-11,16,18-19,28H,12-15,17,20H2,1-4H3 |
| InChIKey | LBBHASUBZCHMAI-UHFFFAOYSA-N |
| XLogP | 17.74 |
| TPSA | 206.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 117 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1576.93 |
| LogP ≤ 5 | 17.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|