About (4R)-3,3-difluoro-4-hydroxypyrrolidin-2-one;propane
(4R)-3,3-difluoro-4-hydroxypyrrolidin-2-one;propane (PubChem CID 159301112) has the molecular formula C7H13F2NO2
and a molecular weight of 181.18 g/mol. Its IUPAC name is (4R)-3,3-difluoro-4-hydroxypyrrolidin-2-one;propane.
Molecular Properties
| Compound Name | (4R)-3,3-difluoro-4-hydroxypyrrolidin-2-one;propane |
| PubChem CID | 159301112 |
| Molecular Formula | C7H13F2NO2 |
| Molecular Weight | 181.18 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | (4R)-3,3-difluoro-4-hydroxypyrrolidin-2-one;propane |
| SMILES | CCC.O=C1NC[C@@H](O)C1(F)F |
| InChI | InChI=1S/C4H5F2NO2.C3H8/c5-4(6)2(8)1-7-3(4)9;1-3-2/h2,8H,1H2,(H,7,9);3H2,1-2H3/t2-;/m1./s1 |
| InChIKey | LBIREZCVTJADNK-HSHFZTNMSA-N |
| XLogP | 0.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.18 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-3,3-difluoro-4-hydroxypyrrolidin-2-one;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-3,3-difluoro-4-hydroxypyrrolidin-2-one;propane?
The IUPAC name of (4R)-3,3-difluoro-4-hydroxypyrrolidin-2-one;propane (CID 159301112) is (4R)-3,3-difluoro-4-hydroxypyrrolidin-2-one;propane.
What is the SMILES notation for (4R)-3,3-difluoro-4-hydroxypyrrolidin-2-one;propane?
The canonical SMILES for (4R)-3,3-difluoro-4-hydroxypyrrolidin-2-one;propane is CCC.O=C1NC[C@@H](O)C1(F)F.
What is the InChIKey of (4R)-3,3-difluoro-4-hydroxypyrrolidin-2-one;propane?
The InChIKey is LBIREZCVTJADNK-HSHFZTNMSA-N. The full InChI is InChI=1S/C4H5F2NO2.C3H8/c5-4(6)2(8)1-7-3(4)9;1-3-2/h2,8H,1H2,(H,7,9);3H2,1-2H3/t2-;/m1./s1.
What are the key properties of (4R)-3,3-difluoro-4-hydroxypyrrolidin-2-one;propane?
(4R)-3,3-difluoro-4-hydroxypyrrolidin-2-one;propane has a molecular weight of 181.18 g/mol, XLogP of 0.53, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-3,3-difluoro-4-hydroxypyrrolidin-2-one;propane is sourced from PubChem (CID 159301112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).