C18H26FNO2S — CID 159301963
(R)-N-[(2S)-2-[2-fluoro-5-(2-oxopropyl)phenyl]pent-4-en-2-yl]-2-methylpropane-2-sulfinamide (PubChem CID 159301963) has the molecular formula C18H26FNO2S and a molecular weight of 339.48 g/mol. Its IUPAC name is (R)-N-[(2S)-2-[2-fluoro-5-(2-oxopropyl)phenyl]pent-4-en-2-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(2S)-2-[2-fluoro-5-(2-oxopropyl)phenyl]pent-4-en-2-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 159301963 |
| Molecular Formula | C18H26FNO2S |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (R)-N-[(2S)-2-[2-fluoro-5-(2-oxopropyl)phenyl]pent-4-en-2-yl]-2-methylpropane-2-sulfinamide |
| SMILES | C=CC[C@](C)(N[S@](=O)C(C)(C)C)c1cc(CC(C)=O)ccc1F |
| InChI | InChI=1S/C18H26FNO2S/c1-7-10-18(6,20-23(22)17(3,4)5)15-12-14(11-13(2)21)8-9-16(15)19/h7-9,12,20H,1,10-11H2,2-6H3/t18-,23+/m0/s1 |
| InChIKey | MWEUUSYXQNOGQW-FDDCHVKYSA-N |
| XLogP | 3.80 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|