C21H21BrN4O2Si — CID 159302744
6-bromo-1H-1,8-naphthyridin-2-one;6-(2-trimethylsilylethenyl)-1H-1,8-naphthyridin-2-one (PubChem CID 159302744) has the molecular formula C21H21BrN4O2Si and a molecular weight of 469.42 g/mol. Its IUPAC name is 6-bromo-1H-1,8-naphthyridin-2-one;6-(2-trimethylsilylethenyl)-1H-1,8-naphthyridin-2-one.
| Compound Name | 6-bromo-1H-1,8-naphthyridin-2-one;6-(2-trimethylsilylethenyl)-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 159302744 |
| Molecular Formula | C21H21BrN4O2Si |
| Molecular Weight | 469.42 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | 6-bromo-1H-1,8-naphthyridin-2-one;6-(2-trimethylsilylethenyl)-1H-1,8-naphthyridin-2-one |
| SMILES | C[Si](C)(C)C=Cc1cnc2[nH]c(=O)ccc2c1.O=c1ccc2cc(Br)cnc2[nH]1 |
| InChI | InChI=1S/C13H16N2OSi.C8H5BrN2O/c1-17(2,3)7-6-10-8-11-4-5-12(16)15-13(11)14-9-10;9-6-3-5-1-2-7(12)11-8(5)10-4-6/h4-9H,1-3H3,(H,14,15,16);1-4H,(H,10,11,12) |
| InChIKey | LBNQSDUEZRMNHC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|