About 5,6-dimethyl-1-propan-2-ylbenzotriazole;ethene;N-propan-2-ylcyclopropanesulfonamide
5,6-dimethyl-1-propan-2-ylbenzotriazole;ethene;N-propan-2-ylcyclopropanesulfonamide (PubChem CID 159302900) has the molecular formula C25H44N4O2S
and a molecular weight of 464.72 g/mol. Its IUPAC name is 5,6-dimethyl-1-propan-2-ylbenzotriazole;ethene;N-propan-2-ylcyclopropanesulfonamide.
Molecular Properties
| Compound Name | 5,6-dimethyl-1-propan-2-ylbenzotriazole;ethene;N-propan-2-ylcyclopropanesulfonamide |
| PubChem CID | 159302900 |
| Molecular Formula | C25H44N4O2S |
| Molecular Weight | 464.72 g/mol |
| Exact Mass | 464.32 |
| IUPAC Name | 5,6-dimethyl-1-propan-2-ylbenzotriazole;ethene;N-propan-2-ylcyclopropanesulfonamide |
| SMILES | C=C.C=C.C=C.C=C.CC(C)NS(=O)(=O)C1CC1.Cc1cc2nnn(C(C)C)c2cc1C |
| InChI | InChI=1S/C11H15N3.C6H13NO2S.4C2H4/c1-7(2)14-11-6-9(4)8(3)5-10(11)12-13-14;1-5(2)7-10(8,9)6-3-4-6;4*1-2/h5-7H,1-4H3;5-7H,3-4H2,1-2H3;4*1-2H2 |
| InChIKey | LBOBSXDYALYHFB-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.72 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dimethyl-1-propan-2-ylbenzotriazole;ethene;N-propan-2-ylcyclopropanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-1-propan-2-ylbenzotriazole;ethene;N-propan-2-ylcyclopropanesulfonamide?
The IUPAC name of 5,6-dimethyl-1-propan-2-ylbenzotriazole;ethene;N-propan-2-ylcyclopropanesulfonamide (CID 159302900) is 5,6-dimethyl-1-propan-2-ylbenzotriazole;ethene;N-propan-2-ylcyclopropanesulfonamide.
What is the SMILES notation for 5,6-dimethyl-1-propan-2-ylbenzotriazole;ethene;N-propan-2-ylcyclopropanesulfonamide?
The canonical SMILES for 5,6-dimethyl-1-propan-2-ylbenzotriazole;ethene;N-propan-2-ylcyclopropanesulfonamide is C=C.C=C.C=C.C=C.CC(C)NS(=O)(=O)C1CC1.Cc1cc2nnn(C(C)C)c2cc1C.
What is the InChIKey of 5,6-dimethyl-1-propan-2-ylbenzotriazole;ethene;N-propan-2-ylcyclopropanesulfonamide?
The InChIKey is LBOBSXDYALYHFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3.C6H13NO2S.4C2H4/c1-7(2)14-11-6-9(4)8(3)5-10(11)12-13-14;1-5(2)7-10(8,9)6-3-4-6;4*1-2/h5-7H,1-4H3;5-7H,3-4H2,1-2H3;4*1-2H2.
What are the key properties of 5,6-dimethyl-1-propan-2-ylbenzotriazole;ethene;N-propan-2-ylcyclopropanesulfonamide?
5,6-dimethyl-1-propan-2-ylbenzotriazole;ethene;N-propan-2-ylcyclopropanesulfonamide has a molecular weight of 464.72 g/mol, XLogP of 6.31, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-1-propan-2-ylbenzotriazole;ethene;N-propan-2-ylcyclopropanesulfonamide is sourced from PubChem (CID 159302900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).