C41H22F6N8O8 — CID 159302915
(5-aminopyrimidin-2-yl) 2-[4-[2-[4-[5-(5-aminopyrimidin-2-yl)oxycarbonyl-1,3-dioxoisoindol-2-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 159302915) has the molecular formula C41H22F6N8O8 and a molecular weight of 868.66 g/mol. Its IUPAC name is (5-aminopyrimidin-2-yl) 2-[4-[2-[4-[5-(5-aminopyrimidin-2-yl)oxycarbonyl-1,3-dioxoisoindol-2-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (5-aminopyrimidin-2-yl) 2-[4-[2-[4-[5-(5-aminopyrimidin-2-yl)oxycarbonyl-1,3-dioxoisoindol-2-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 159302915 |
| Molecular Formula | C41H22F6N8O8 |
| Molecular Weight | 868.66 g/mol |
| Exact Mass | 868.15 |
| IUPAC Name | (5-aminopyrimidin-2-yl) 2-[4-[2-[4-[5-(5-aminopyrimidin-2-yl)oxycarbonyl-1,3-dioxoisoindol-2-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Nc1cnc(OC(=O)c2ccc3c(c2)C(=O)N(c2ccc(C(c4ccc(N5C(=O)c6ccc(C(=O)Oc7ncc(N)cn7)cc6C5=O)cc4)(C(F)(F)F)C(F)(F)F)cc2)C3=O)nc1 |
| InChI | InChI=1S/C41H22F6N8O8/c42-40(43,44)39(41(45,46)47,21-3-7-25(8-4-21)54-31(56)27-11-1-19(13-29(27)33(54)58)35(60)62-37-50-15-23(48)16-51-37)22-5-9-26(10-6-22)55-32(57)28-12-2-20(14-30(28)34(55)59)36(61)63-38-52-17-24(49)18-53-38/h1-18H,48-49H2 |
| InChIKey | XDFKVJJXTAUINR-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 230.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.66 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|