C20H34S — CID 159303121
4-methyl-1-propan-2-ylcyclohex-3-ene-1-thiol;1-methyl-4-propan-2-ylidenecyclohexene (PubChem CID 159303121) has the molecular formula C20H34S and a molecular weight of 306.56 g/mol. Its IUPAC name is 4-methyl-1-propan-2-ylcyclohex-3-ene-1-thiol;1-methyl-4-propan-2-ylidenecyclohexene.
| Compound Name | 4-methyl-1-propan-2-ylcyclohex-3-ene-1-thiol;1-methyl-4-propan-2-ylidenecyclohexene |
|---|---|
| PubChem CID | 159303121 |
| Molecular Formula | C20H34S |
| Molecular Weight | 306.56 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | 4-methyl-1-propan-2-ylcyclohex-3-ene-1-thiol;1-methyl-4-propan-2-ylidenecyclohexene |
| SMILES | CC1=CCC(=C(C)C)CC1.CC1=CCC(S)(C(C)C)CC1 |
| InChI | InChI=1S/C10H18S.C10H16/c1-8(2)10(11)6-4-9(3)5-7-10;1-8(2)10-6-4-9(3)5-7-10/h4,8,11H,5-7H2,1-3H3;4H,5-7H2,1-3H3 |
| InChIKey | LBOULHFTVISIHQ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.56 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|