About 1-ethenylpyrrolidin-2-one;2-methylpropane-1-sulfonic acid;prop-2-enamide
1-ethenylpyrrolidin-2-one;2-methylpropane-1-sulfonic acid;prop-2-enamide (PubChem CID 159303178) has the molecular formula C13H24N2O5S
and a molecular weight of 320.41 g/mol. Its IUPAC name is 1-ethenylpyrrolidin-2-one;2-methylpropane-1-sulfonic acid;prop-2-enamide.
Molecular Properties
| Compound Name | 1-ethenylpyrrolidin-2-one;2-methylpropane-1-sulfonic acid;prop-2-enamide |
| PubChem CID | 159303178 |
| Molecular Formula | C13H24N2O5S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 1-ethenylpyrrolidin-2-one;2-methylpropane-1-sulfonic acid;prop-2-enamide |
| SMILES | C=CC(N)=O.C=CN1CCCC1=O.CC(C)CS(=O)(=O)O |
| InChI | InChI=1S/C6H9NO.C4H10O3S.C3H5NO/c1-2-7-5-3-4-6(7)8;1-4(2)3-8(5,6)7;1-2-3(4)5/h2H,1,3-5H2;4H,3H2,1-2H3,(H,5,6,7);2H,1H2,(H2,4,5) |
| InChIKey | LBOYSMSAETXZBA-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenylpyrrolidin-2-one;2-methylpropane-1-sulfonic acid;prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenylpyrrolidin-2-one;2-methylpropane-1-sulfonic acid;prop-2-enamide?
The IUPAC name of 1-ethenylpyrrolidin-2-one;2-methylpropane-1-sulfonic acid;prop-2-enamide (CID 159303178) is 1-ethenylpyrrolidin-2-one;2-methylpropane-1-sulfonic acid;prop-2-enamide.
What is the SMILES notation for 1-ethenylpyrrolidin-2-one;2-methylpropane-1-sulfonic acid;prop-2-enamide?
The canonical SMILES for 1-ethenylpyrrolidin-2-one;2-methylpropane-1-sulfonic acid;prop-2-enamide is C=CC(N)=O.C=CN1CCCC1=O.CC(C)CS(=O)(=O)O.
What is the InChIKey of 1-ethenylpyrrolidin-2-one;2-methylpropane-1-sulfonic acid;prop-2-enamide?
The InChIKey is LBOYSMSAETXZBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO.C4H10O3S.C3H5NO/c1-2-7-5-3-4-6(7)8;1-4(2)3-8(5,6)7;1-2-3(4)5/h2H,1,3-5H2;4H,3H2,1-2H3,(H,5,6,7);2H,1H2,(H2,4,5).
What are the key properties of 1-ethenylpyrrolidin-2-one;2-methylpropane-1-sulfonic acid;prop-2-enamide?
1-ethenylpyrrolidin-2-one;2-methylpropane-1-sulfonic acid;prop-2-enamide has a molecular weight of 320.41 g/mol, XLogP of 0.94, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenylpyrrolidin-2-one;2-methylpropane-1-sulfonic acid;prop-2-enamide is sourced from PubChem (CID 159303178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).