About 2-[2-(dimethylamino)ethylamino]-5H-benzimidazolo[1,2-a][1,8]naphthyridin-6-one
2-[2-(dimethylamino)ethylamino]-5H-benzimidazolo[1,2-a][1,8]naphthyridin-6-one (PubChem CID 159303718) has the molecular formula C18H19N5O
and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethylamino]-5H-benzimidazolo[1,2-a][1,8]naphthyridin-6-one.
Molecular Properties
| Compound Name | 2-[2-(dimethylamino)ethylamino]-5H-benzimidazolo[1,2-a][1,8]naphthyridin-6-one |
| PubChem CID | 159303718 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 2-[2-(dimethylamino)ethylamino]-5H-benzimidazolo[1,2-a][1,8]naphthyridin-6-one |
| SMILES | CN(C)CCNc1ccc2c(n1)-n1c(nc3ccccc31)C(=O)C2 |
| InChI | InChI=1S/C18H19N5O/c1-22(2)10-9-19-16-8-7-12-11-15(24)18-20-13-5-3-4-6-14(13)23(18)17(12)21-16/h3-8H,9-11H2,1-2H3,(H,19,21) |
| InChIKey | ZJKPBPHEKZGBLC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[2-(dimethylamino)ethylamino]-5H-benzimidazolo[1,2-a][1,8]naphthyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(dimethylamino)ethylamino]-5H-benzimidazolo[1,2-a][1,8]naphthyridin-6-one?
The IUPAC name of 2-[2-(dimethylamino)ethylamino]-5H-benzimidazolo[1,2-a][1,8]naphthyridin-6-one (CID 159303718) is 2-[2-(dimethylamino)ethylamino]-5H-benzimidazolo[1,2-a][1,8]naphthyridin-6-one.
What is the SMILES notation for 2-[2-(dimethylamino)ethylamino]-5H-benzimidazolo[1,2-a][1,8]naphthyridin-6-one?
The canonical SMILES for 2-[2-(dimethylamino)ethylamino]-5H-benzimidazolo[1,2-a][1,8]naphthyridin-6-one is CN(C)CCNc1ccc2c(n1)-n1c(nc3ccccc31)C(=O)C2.
What is the InChIKey of 2-[2-(dimethylamino)ethylamino]-5H-benzimidazolo[1,2-a][1,8]naphthyridin-6-one?
The InChIKey is ZJKPBPHEKZGBLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N5O/c1-22(2)10-9-19-16-8-7-12-11-15(24)18-20-13-5-3-4-6-14(13)23(18)17(12)21-16/h3-8H,9-11H2,1-2H3,(H,19,21).
What are the key properties of 2-[2-(dimethylamino)ethylamino]-5H-benzimidazolo[1,2-a][1,8]naphthyridin-6-one?
2-[2-(dimethylamino)ethylamino]-5H-benzimidazolo[1,2-a][1,8]naphthyridin-6-one has a molecular weight of 321.38 g/mol, XLogP of 2.13, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(dimethylamino)ethylamino]-5H-benzimidazolo[1,2-a][1,8]naphthyridin-6-one is sourced from PubChem (CID 159303718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).