About (4Z)-5-(butan-2-ylideneamino)hepta-1,4-dien-3-ol
(4Z)-5-(butan-2-ylideneamino)hepta-1,4-dien-3-ol (PubChem CID 159305024) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is (4Z)-5-(butan-2-ylideneamino)hepta-1,4-dien-3-ol.
Molecular Properties
| Compound Name | (4Z)-5-(butan-2-ylideneamino)hepta-1,4-dien-3-ol |
| PubChem CID | 159305024 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (4Z)-5-(butan-2-ylideneamino)hepta-1,4-dien-3-ol |
| SMILES | C=CC(O)/C=C(CC)\N=C(/C)CC |
| InChI | InChI=1S/C11H19NO/c1-5-9(4)12-10(6-2)8-11(13)7-3/h7-8,11,13H,3,5-6H2,1-2,4H3/b10-8-,12-9+ |
| InChIKey | LBURFMULEOBQRJ-XXBUAHSKSA-N |
| XLogP | 2.70 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-5-(butan-2-ylideneamino)hepta-1,4-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-5-(butan-2-ylideneamino)hepta-1,4-dien-3-ol?
The IUPAC name of (4Z)-5-(butan-2-ylideneamino)hepta-1,4-dien-3-ol (CID 159305024) is (4Z)-5-(butan-2-ylideneamino)hepta-1,4-dien-3-ol.
What is the SMILES notation for (4Z)-5-(butan-2-ylideneamino)hepta-1,4-dien-3-ol?
The canonical SMILES for (4Z)-5-(butan-2-ylideneamino)hepta-1,4-dien-3-ol is C=CC(O)/C=C(CC)\N=C(/C)CC.
What is the InChIKey of (4Z)-5-(butan-2-ylideneamino)hepta-1,4-dien-3-ol?
The InChIKey is LBURFMULEOBQRJ-XXBUAHSKSA-N. The full InChI is InChI=1S/C11H19NO/c1-5-9(4)12-10(6-2)8-11(13)7-3/h7-8,11,13H,3,5-6H2,1-2,4H3/b10-8-,12-9+.
What are the key properties of (4Z)-5-(butan-2-ylideneamino)hepta-1,4-dien-3-ol?
(4Z)-5-(butan-2-ylideneamino)hepta-1,4-dien-3-ol has a molecular weight of 181.28 g/mol, XLogP of 2.70, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-5-(butan-2-ylideneamino)hepta-1,4-dien-3-ol is sourced from PubChem (CID 159305024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).