About 1,1-dimethyl-3,4-dimethylidenepyrrolidin-1-ium chloride
1,1-dimethyl-3,4-dimethylidenepyrrolidin-1-ium chloride (PubChem CID 15930704) has the molecular formula C8H14ClN
and a molecular weight of 159.66 g/mol. Its IUPAC name is 1,1-dimethyl-3,4-dimethylidenepyrrolidin-1-ium chloride.
Molecular Properties
| Compound Name | 1,1-dimethyl-3,4-dimethylidenepyrrolidin-1-ium chloride |
|---|
| PubChem CID | 15930704 |
|---|
| Molecular Formula | C8H14ClN |
|---|
| Molecular Weight | 159.66 g/mol |
|---|
| Exact Mass | 159.08 |
|---|
| IUPAC Name | 1,1-dimethyl-3,4-dimethylidenepyrrolidin-1-ium chloride |
|---|
| SMILES | C=C1C[N+](C)(C)CC1=C.[Cl-] |
|---|
| InChI | InChI=1S/C8H14N.ClH/c1-7-5-9(3,4)6-8(7)2;/h1-2,5-6H2,3-4H3;1H/q+1;/p-1 |
|---|
| InChIKey | AYUAMLSLQAETOF-UHFFFAOYSA-M |
|---|
| XLogP | -1.81 |
|---|
| TPSA | 0.00 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 10 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 159.66 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethyl-3,4-dimethylidenepyrrolidin-1-ium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethyl-3,4-dimethylidenepyrrolidin-1-ium chloride?
The IUPAC name of 1,1-dimethyl-3,4-dimethylidenepyrrolidin-1-ium chloride (CID 15930704) is 1,1-dimethyl-3,4-dimethylidenepyrrolidin-1-ium chloride.
What is the SMILES notation for 1,1-dimethyl-3,4-dimethylidenepyrrolidin-1-ium chloride?
The canonical SMILES for 1,1-dimethyl-3,4-dimethylidenepyrrolidin-1-ium chloride is C=C1C[N+](C)(C)CC1=C.[Cl-].
What is the InChIKey of 1,1-dimethyl-3,4-dimethylidenepyrrolidin-1-ium chloride?
The InChIKey is AYUAMLSLQAETOF-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H14N.ClH/c1-7-5-9(3,4)6-8(7)2;/h1-2,5-6H2,3-4H3;1H/q+1;/p-1.
What are the key properties of 1,1-dimethyl-3,4-dimethylidenepyrrolidin-1-ium chloride?
1,1-dimethyl-3,4-dimethylidenepyrrolidin-1-ium chloride has a molecular weight of 159.66 g/mol, XLogP of -1.81, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethyl-3,4-dimethylidenepyrrolidin-1-ium chloride is sourced from PubChem (CID 15930704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).