About 2,5-bis(butylperoxy)-2,5-dimethylhexane
2,5-bis(butylperoxy)-2,5-dimethylhexane (PubChem CID 15930850) has the molecular formula C16H34O4
and a molecular weight of 290.44 g/mol. Its IUPAC name is 2,5-bis(butylperoxy)-2,5-dimethylhexane.
Molecular Properties
| Compound Name | 2,5-bis(butylperoxy)-2,5-dimethylhexane |
| PubChem CID | 15930850 |
| Molecular Formula | C16H34O4 |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | 2,5-bis(butylperoxy)-2,5-dimethylhexane |
| SMILES | CCCCOOC(C)(C)CCC(C)(C)OOCCCC |
| InChI | InChI=1S/C16H34O4/c1-7-9-13-17-19-15(3,4)11-12-16(5,6)20-18-14-10-8-2/h7-14H2,1-6H3 |
| InChIKey | XMYJXSITMZVPFY-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2,5-bis(butylperoxy)-2,5-dimethylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(butylperoxy)-2,5-dimethylhexane?
The IUPAC name of 2,5-bis(butylperoxy)-2,5-dimethylhexane (CID 15930850) is 2,5-bis(butylperoxy)-2,5-dimethylhexane.
What is the SMILES notation for 2,5-bis(butylperoxy)-2,5-dimethylhexane?
The canonical SMILES for 2,5-bis(butylperoxy)-2,5-dimethylhexane is CCCCOOC(C)(C)CCC(C)(C)OOCCCC.
What is the InChIKey of 2,5-bis(butylperoxy)-2,5-dimethylhexane?
The InChIKey is XMYJXSITMZVPFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O4/c1-7-9-13-17-19-15(3,4)11-12-16(5,6)20-18-14-10-8-2/h7-14H2,1-6H3.
What are the key properties of 2,5-bis(butylperoxy)-2,5-dimethylhexane?
2,5-bis(butylperoxy)-2,5-dimethylhexane has a molecular weight of 290.44 g/mol, XLogP of 4.82, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(butylperoxy)-2,5-dimethylhexane is sourced from PubChem (CID 15930850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).