C28H38N4O3 — CID 15931
1,3-bis[4-(diethylamino)but-2-ynyl]-5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione (PubChem CID 15931) has the molecular formula C28H38N4O3 and a molecular weight of 478.64 g/mol. Its IUPAC name is 1,3-bis[4-(diethylamino)but-2-ynyl]-5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-bis[4-(diethylamino)but-2-ynyl]-5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 15931 |
| Molecular Formula | C28H38N4O3 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | 1,3-bis[4-(diethylamino)but-2-ynyl]-5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCN(CC)CC#CCN1C(=O)N(CC#CCN(CC)CC)C(=O)C(CC)(c2ccccc2)C1=O |
| InChI | InChI=1S/C28H38N4O3/c1-6-28(24-18-12-11-13-19-24)25(33)31(22-16-14-20-29(7-2)8-3)27(35)32(26(28)34)23-17-15-21-30(9-4)10-5/h11-13,18-19H,6-10,20-23H2,1-5H3 |
| InChIKey | ICASDAVVPDNQRW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|