C9H19NO4S — CID 159311966
(2,2,6,6-tetramethylpiperidin-1-yl) hydrogen sulfate (PubChem CID 159311966) has the molecular formula C9H19NO4S and a molecular weight of 237.32 g/mol. Its IUPAC name is (2,2,6,6-tetramethylpiperidin-1-yl) hydrogen sulfate.
| Compound Name | (2,2,6,6-tetramethylpiperidin-1-yl) hydrogen sulfate |
|---|---|
| PubChem CID | 159311966 |
| Molecular Formula | C9H19NO4S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | (2,2,6,6-tetramethylpiperidin-1-yl) hydrogen sulfate |
| SMILES | CC1(C)CCCC(C)(C)N1OS(=O)(=O)O |
| InChI | InChI=1S/C9H19NO4S/c1-8(2)6-5-7-9(3,4)10(8)14-15(11,12)13/h5-7H2,1-4H3,(H,11,12,13) |
| InChIKey | LCQVYXDEYQWBKY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|