C15H14FN3O3S — CID 159312440
N-(4-fluorophenyl)-2-[[5-(2-hydroxyethenyl)-4-methyl-6-oxo-1H-pyrimidin-2-yl]sulfanyl]acetamide (PubChem CID 159312440) has the molecular formula C15H14FN3O3S and a molecular weight of 335.36 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[[5-(2-hydroxyethenyl)-4-methyl-6-oxo-1H-pyrimidin-2-yl]sulfanyl]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[[5-(2-hydroxyethenyl)-4-methyl-6-oxo-1H-pyrimidin-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 159312440 |
| Molecular Formula | C15H14FN3O3S |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | N-(4-fluorophenyl)-2-[[5-(2-hydroxyethenyl)-4-methyl-6-oxo-1H-pyrimidin-2-yl]sulfanyl]acetamide |
| SMILES | Cc1nc(SCC(=O)Nc2ccc(F)cc2)[nH]c(=O)c1C=CO |
| InChI | InChI=1S/C15H14FN3O3S/c1-9-12(6-7-20)14(22)19-15(17-9)23-8-13(21)18-11-4-2-10(16)3-5-11/h2-7,20H,8H2,1H3,(H,18,21)(H,17,19,22) |
| InChIKey | FSAMCZMLRUPQTE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|