About N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)formamide
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)formamide (PubChem CID 15931311) has the molecular formula C9H14N4O3
and a molecular weight of 226.24 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)formamide.
Molecular Properties
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)formamide |
| PubChem CID | 15931311 |
| Molecular Formula | C9H14N4O3 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)formamide |
| SMILES | CCCCn1c(N)c(NC=O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H14N4O3/c1-2-3-4-13-7(10)6(11-5-14)8(15)12-9(13)16/h5H,2-4,10H2,1H3,(H,11,14)(H,12,15,16) |
| InChIKey | PYPVYGKAJIDXSX-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)formamide?
The IUPAC name of N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)formamide (CID 15931311) is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)formamide.
What is the SMILES notation for N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)formamide?
The canonical SMILES for N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)formamide is CCCCn1c(N)c(NC=O)c(=O)[nH]c1=O.
What is the InChIKey of N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)formamide?
The InChIKey is PYPVYGKAJIDXSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O3/c1-2-3-4-13-7(10)6(11-5-14)8(15)12-9(13)16/h5H,2-4,10H2,1H3,(H,11,14)(H,12,15,16).
What are the key properties of N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)formamide?
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)formamide has a molecular weight of 226.24 g/mol, XLogP of -0.51, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)formamide is sourced from PubChem (CID 15931311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).