About methane;2-(5-methylimidazol-1-yl)acetic acid
methane;2-(5-methylimidazol-1-yl)acetic acid (PubChem CID 159313681) has the molecular formula C7H12N2O2
and a molecular weight of 156.18 g/mol. Its IUPAC name is methane;2-(5-methylimidazol-1-yl)acetic acid.
Molecular Properties
| Compound Name | methane;2-(5-methylimidazol-1-yl)acetic acid |
| PubChem CID | 159313681 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | methane;2-(5-methylimidazol-1-yl)acetic acid |
| SMILES | C.Cc1cncn1CC(=O)O |
| InChI | InChI=1S/C6H8N2O2.CH4/c1-5-2-7-4-8(5)3-6(9)10;/h2,4H,3H2,1H3,(H,9,10);1H4 |
| InChIKey | LCWCBQKUTIAPQH-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methane;2-(5-methylimidazol-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-(5-methylimidazol-1-yl)acetic acid?
The IUPAC name of methane;2-(5-methylimidazol-1-yl)acetic acid (CID 159313681) is methane;2-(5-methylimidazol-1-yl)acetic acid.
What is the SMILES notation for methane;2-(5-methylimidazol-1-yl)acetic acid?
The canonical SMILES for methane;2-(5-methylimidazol-1-yl)acetic acid is C.Cc1cncn1CC(=O)O.
What is the InChIKey of methane;2-(5-methylimidazol-1-yl)acetic acid?
The InChIKey is LCWCBQKUTIAPQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2.CH4/c1-5-2-7-4-8(5)3-6(9)10;/h2,4H,3H2,1H3,(H,9,10);1H4.
What are the key properties of methane;2-(5-methylimidazol-1-yl)acetic acid?
methane;2-(5-methylimidazol-1-yl)acetic acid has a molecular weight of 156.18 g/mol, XLogP of 0.91, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-(5-methylimidazol-1-yl)acetic acid is sourced from PubChem (CID 159313681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).