C39H24N2O2 — CID 159315243
9-(9-dibenzofuran-3-yl-6-isocyanodibenzofuran-4-yl)-3,6-dimethylcarbazole (PubChem CID 159315243) has the molecular formula C39H24N2O2 and a molecular weight of 552.63 g/mol. Its IUPAC name is 9-(9-dibenzofuran-3-yl-6-isocyanodibenzofuran-4-yl)-3,6-dimethylcarbazole.
| Compound Name | 9-(9-dibenzofuran-3-yl-6-isocyanodibenzofuran-4-yl)-3,6-dimethylcarbazole |
|---|---|
| PubChem CID | 159315243 |
| Molecular Formula | C39H24N2O2 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | 9-(9-dibenzofuran-3-yl-6-isocyanodibenzofuran-4-yl)-3,6-dimethylcarbazole |
| SMILES | [C-]#[N+]c1ccc(-c2ccc3c(c2)oc2ccccc23)c2c1oc1c(-n3c4ccc(C)cc4c4cc(C)ccc43)cccc12 |
| InChI | InChI=1S/C39H24N2O2/c1-22-11-17-32-29(19-22)30-20-23(2)12-18-33(30)41(32)34-9-6-8-28-37-25(15-16-31(40-3)39(37)43-38(28)34)24-13-14-27-26-7-4-5-10-35(26)42-36(27)21-24/h4-21H,1-2H3 |
| InChIKey | KCCFATASWNUGSA-UHFFFAOYSA-N |
| XLogP | 11.42 |
| TPSA | 35.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|