About oct-1-enylbenzene;phosphoric acid
oct-1-enylbenzene;phosphoric acid (PubChem CID 159316508) has the molecular formula C14H23O4P
and a molecular weight of 286.31 g/mol. Its IUPAC name is oct-1-enylbenzene;phosphoric acid.
Molecular Properties
| Compound Name | oct-1-enylbenzene;phosphoric acid |
| PubChem CID | 159316508 |
| Molecular Formula | C14H23O4P |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | oct-1-enylbenzene;phosphoric acid |
| SMILES | CCCCCCC=Cc1ccccc1.O=P(O)(O)O |
| InChI | InChI=1S/C14H20.H3O4P/c1-2-3-4-5-6-8-11-14-12-9-7-10-13-14;1-5(2,3)4/h7-13H,2-6H2,1H3;(H3,1,2,3,4) |
| InChIKey | LDEYGNLOONUDPM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze oct-1-enylbenzene;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oct-1-enylbenzene;phosphoric acid?
The IUPAC name of oct-1-enylbenzene;phosphoric acid (CID 159316508) is oct-1-enylbenzene;phosphoric acid.
What is the SMILES notation for oct-1-enylbenzene;phosphoric acid?
The canonical SMILES for oct-1-enylbenzene;phosphoric acid is CCCCCCC=Cc1ccccc1.O=P(O)(O)O.
What is the InChIKey of oct-1-enylbenzene;phosphoric acid?
The InChIKey is LDEYGNLOONUDPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20.H3O4P/c1-2-3-4-5-6-8-11-14-12-9-7-10-13-14;1-5(2,3)4/h7-13H,2-6H2,1H3;(H3,1,2,3,4).
What are the key properties of oct-1-enylbenzene;phosphoric acid?
oct-1-enylbenzene;phosphoric acid has a molecular weight of 286.31 g/mol, XLogP of 3.74, 6 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for oct-1-enylbenzene;phosphoric acid is sourced from PubChem (CID 159316508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).